C30H49BN2O8 — CID 155589037
tert-butyl (2S,3R)-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2-(phenylmethoxycarbonylamino)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate (PubChem CID 155589037) has the molecular formula C30H49BN2O8 and a molecular weight of 576.54 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2-(phenylmethoxycarbonylamino)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate.
| Compound Name | tert-butyl (2S,3R)-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2-(phenylmethoxycarbonylamino)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
|---|---|
| PubChem CID | 155589037 |
| Molecular Formula | C30H49BN2O8 |
| Molecular Weight | 576.54 g/mol |
| Exact Mass | 576.36 |
| IUPAC Name | tert-butyl (2S,3R)-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2-(phenylmethoxycarbonylamino)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](CCCB1OC(C)(C)C(C)(C)O1)[C@H](NC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H49BN2O8/c1-27(2,3)38-24(34)23(33-26(36)37-20-21-15-12-11-13-16-21)22(19-32-25(35)39-28(4,5)6)17-14-18-31-40-29(7,8)30(9,10)41-31/h11-13,15-16,22-23H,14,17-20H2,1-10H3,(H,32,35)(H,33,36)/t22-,23+/m1/s1 |
| InChIKey | ZJHCYNMJBONPAX-PKTZIBPZSA-N |
| XLogP | 5.64 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|