C24H45BN2O7 — CID 167706309
tert-butyl (2S,3S)-2-acetamido-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate (PubChem CID 167706309) has the molecular formula C24H45BN2O7 and a molecular weight of 484.44 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-acetamido-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate.
| Compound Name | tert-butyl (2S,3S)-2-acetamido-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
|---|---|
| PubChem CID | 167706309 |
| Molecular Formula | C24H45BN2O7 |
| Molecular Weight | 484.44 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | tert-butyl (2S,3S)-2-acetamido-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
| SMILES | CC(=O)N[C@H](C(=O)OC(C)(C)C)[C@@H](CCCB1OC(C)(C)C(C)(C)O1)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H45BN2O7/c1-16(28)27-18(19(29)31-21(2,3)4)17(15-26-20(30)32-22(5,6)7)13-12-14-25-33-23(8,9)24(10,11)34-25/h17-18H,12-15H2,1-11H3,(H,26,30)(H,27,28)/t17-,18-/m0/s1 |
| InChIKey | IZICMJLWGMIFQC-ROUUACIJSA-N |
| XLogP | 3.85 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|