C35H62BN3O7 — CID 153335139
benzyl 4-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]pyrrolidine-2-carboxylate;2-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane (PubChem CID 153335139) has the molecular formula C35H62BN3O7 and a molecular weight of 647.71 g/mol. Its IUPAC name is benzyl 4-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]pyrrolidine-2-carboxylate;2-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane.
| Compound Name | benzyl 4-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]pyrrolidine-2-carboxylate;2-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane |
|---|---|
| PubChem CID | 153335139 |
| Molecular Formula | C35H62BN3O7 |
| Molecular Weight | 647.71 g/mol |
| Exact Mass | 647.47 |
| IUPAC Name | benzyl 4-[[3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]pyrrolidine-2-carboxylate;2-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane |
| SMILES | CC.CCC(C)C(NC(=O)OC(C)(C)C)C(=O)NC1CNC(C(=O)OCc2ccccc2)C1.CCCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H35N3O5.C10H21BO2.C2H6/c1-6-15(2)19(26-22(29)31-23(3,4)5)20(27)25-17-12-18(24-13-17)21(28)30-14-16-10-8-7-9-11-16;1-6-7-8-11-12-9(2,3)10(4,5)13-11;1-2/h7-11,15,17-19,24H,6,12-14H2,1-5H3,(H,25,27)(H,26,29);6-8H2,1-5H3;1-2H3 |
| InChIKey | LYYCYGXZCCYQPU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.71 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|