C18H25F3N2O — CID 5075472
N-[[2-(trifluoromethyl)phenyl]methylideneamino]decanamide (PubChem CID 5075472) has the molecular formula C18H25F3N2O and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[[2-(trifluoromethyl)phenyl]methylideneamino]decanamide.
| Compound Name | N-[[2-(trifluoromethyl)phenyl]methylideneamino]decanamide |
|---|---|
| PubChem CID | 5075472 |
| Molecular Formula | C18H25F3N2O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-[[2-(trifluoromethyl)phenyl]methylideneamino]decanamide |
| SMILES | CCCCCCCCCC(=O)NN=Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H25F3N2O/c1-2-3-4-5-6-7-8-13-17(24)23-22-14-15-11-9-10-12-16(15)18(19,20)21/h9-12,14H,2-8,13H2,1H3,(H,23,24) |
| InChIKey | HQLVVEYPTCWNLR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|