C13H17N — CID 90872206
4,5-dimethyl-2-methylidenedeca-3,7-dien-9-yn-1-imine (PubChem CID 90872206) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 4,5-dimethyl-2-methylidenedeca-3,7-dien-9-yn-1-imine.
| Compound Name | 4,5-dimethyl-2-methylidenedeca-3,7-dien-9-yn-1-imine |
|---|---|
| PubChem CID | 90872206 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 4,5-dimethyl-2-methylidenedeca-3,7-dien-9-yn-1-imine |
| SMILES | [H]/N=C/C(=C)C=C(C)C(C)CC=CC#C |
| InChI | InChI=1S/C13H17N/c1-5-6-7-8-12(3)13(4)9-11(2)10-14/h1,6-7,9-10,12,14H,2,8H2,3-4H3/b7-6?,13-9?,14-10+ |
| InChIKey | XDSAHISWYMKRNE-GCLVMXRMSA-N |
| XLogP | 3.35 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|