C9H14N2 — CID 89153800
2-imino-1-(6-methylcyclohexa-1,3-dien-1-yl)ethanamine (PubChem CID 89153800) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-imino-1-(6-methylcyclohexa-1,3-dien-1-yl)ethanamine.
| Compound Name | 2-imino-1-(6-methylcyclohexa-1,3-dien-1-yl)ethanamine |
|---|---|
| PubChem CID | 89153800 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2-imino-1-(6-methylcyclohexa-1,3-dien-1-yl)ethanamine |
| SMILES | [H]/N=C/C(N)C1=CC=CCC1C |
| InChI | InChI=1S/C9H14N2/c1-7-4-2-3-5-8(7)9(11)6-10/h2-3,5-7,9-10H,4,11H2,1H3/b10-6+ |
| InChIKey | QALFSATUURSWLJ-UXBLZVDNSA-N |
| XLogP | 1.49 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|