C8H12N2 — CID 89153933
(1R)-1-cyclohexa-2,4-dien-1-yl-2-iminoethanamine (PubChem CID 89153933) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is (1R)-1-cyclohexa-2,4-dien-1-yl-2-iminoethanamine.
| Compound Name | (1R)-1-cyclohexa-2,4-dien-1-yl-2-iminoethanamine |
|---|---|
| PubChem CID | 89153933 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (1R)-1-cyclohexa-2,4-dien-1-yl-2-iminoethanamine |
| SMILES | [H]/N=C/[C@H](N)C1C=CC=CC1 |
| InChI | InChI=1S/C8H12N2/c9-6-8(10)7-4-2-1-3-5-7/h1-4,6-9H,5,10H2/b9-6+/t7?,8-/m0/s1 |
| InChIKey | GUSWQHZNHQQRDH-MNGWHVNVSA-N |
| XLogP | 1.10 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|