About (1R)-1-cyclohexa-2,4-dien-1-yl-2-iminoethanamine
(1R)-1-cyclohexa-2,4-dien-1-yl-2-iminoethanamine (PubChem CID 89153933) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is (1R)-1-cyclohexa-2,4-dien-1-yl-2-iminoethanamine.
Molecular Properties
| Compound Name | (1R)-1-cyclohexa-2,4-dien-1-yl-2-iminoethanamine |
| PubChem CID | 89153933 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (1R)-1-cyclohexa-2,4-dien-1-yl-2-iminoethanamine |
| SMILES | [H]/N=C/[C@H](N)C1C=CC=CC1 |
| InChI | InChI=1S/C8H12N2/c9-6-8(10)7-4-2-1-3-5-7/h1-4,6-9H,5,10H2/b9-6+/t7?,8-/m0/s1 |
| InChIKey | GUSWQHZNHQQRDH-MNGWHVNVSA-N |
| XLogP | 1.10 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-cyclohexa-2,4-dien-1-yl-2-iminoethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-cyclohexa-2,4-dien-1-yl-2-iminoethanamine?
The IUPAC name of (1R)-1-cyclohexa-2,4-dien-1-yl-2-iminoethanamine (CID 89153933) is (1R)-1-cyclohexa-2,4-dien-1-yl-2-iminoethanamine.
What is the SMILES notation for (1R)-1-cyclohexa-2,4-dien-1-yl-2-iminoethanamine?
The canonical SMILES for (1R)-1-cyclohexa-2,4-dien-1-yl-2-iminoethanamine is [H]/N=C/[C@H](N)C1C=CC=CC1.
What is the InChIKey of (1R)-1-cyclohexa-2,4-dien-1-yl-2-iminoethanamine?
The InChIKey is GUSWQHZNHQQRDH-MNGWHVNVSA-N. The full InChI is InChI=1S/C8H12N2/c9-6-8(10)7-4-2-1-3-5-7/h1-4,6-9H,5,10H2/b9-6+/t7?,8-/m0/s1.
What are the key properties of (1R)-1-cyclohexa-2,4-dien-1-yl-2-iminoethanamine?
(1R)-1-cyclohexa-2,4-dien-1-yl-2-iminoethanamine has a molecular weight of 136.20 g/mol, XLogP of 1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-cyclohexa-2,4-dien-1-yl-2-iminoethanamine is sourced from PubChem (CID 89153933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).