C14H14N2 — CID 91398657
6-azatricyclo[9.4.0.03,8]pentadeca-3,5,8,10,12,14-hexaen-2-amine (PubChem CID 91398657) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 6-azatricyclo[9.4.0.03,8]pentadeca-3,5,8,10,12,14-hexaen-2-amine.
| Compound Name | 6-azatricyclo[9.4.0.03,8]pentadeca-3,5,8,10,12,14-hexaen-2-amine |
|---|---|
| PubChem CID | 91398657 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 6-azatricyclo[9.4.0.03,8]pentadeca-3,5,8,10,12,14-hexaen-2-amine |
| SMILES | NC1C2=CC=NCC2=CC=C2C=CC=CC21 |
| InChI | InChI=1S/C14H14N2/c15-14-12-4-2-1-3-10(12)5-6-11-9-16-8-7-13(11)14/h1-8,12,14H,9,15H2 |
| InChIKey | RCUOTJULSWVRDA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |