C10H14N2 — CID 139310310
8a-methyl-7,8-dihydro-6H-quinolin-8-amine (PubChem CID 139310310) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 8a-methyl-7,8-dihydro-6H-quinolin-8-amine.
| Compound Name | 8a-methyl-7,8-dihydro-6H-quinolin-8-amine |
|---|---|
| PubChem CID | 139310310 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 8a-methyl-7,8-dihydro-6H-quinolin-8-amine |
| SMILES | CC12N=CC=CC1=CCCC2N |
| InChI | InChI=1S/C10H14N2/c1-10-8(5-3-7-12-10)4-2-6-9(10)11/h3-5,7,9H,2,6,11H2,1H3 |
| InChIKey | KFEXTEZLDWRKDM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |