C11H15N — CID 57147836
7,7-dimethyl-8,8a-dihydro-6H-quinoline (PubChem CID 57147836) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 7,7-dimethyl-8,8a-dihydro-6H-quinoline.
| Compound Name | 7,7-dimethyl-8,8a-dihydro-6H-quinoline |
|---|---|
| PubChem CID | 57147836 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 7,7-dimethyl-8,8a-dihydro-6H-quinoline |
| SMILES | CC1(C)CC=C2C=CC=NC2C1 |
| InChI | InChI=1S/C11H15N/c1-11(2)6-5-9-4-3-7-12-10(9)8-11/h3-5,7,10H,6,8H2,1-2H3 |
| InChIKey | PMZANDALKMBGEG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |