C14H21N — CID 57045796
8-pentyl-6,7,8,8a-tetrahydroquinoline (PubChem CID 57045796) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 8-pentyl-6,7,8,8a-tetrahydroquinoline.
| Compound Name | 8-pentyl-6,7,8,8a-tetrahydroquinoline |
|---|---|
| PubChem CID | 57045796 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 8-pentyl-6,7,8,8a-tetrahydroquinoline |
| SMILES | CCCCCC1CCC=C2C=CC=NC21 |
| InChI | InChI=1S/C14H21N/c1-2-3-4-7-12-8-5-9-13-10-6-11-15-14(12)13/h6,9-12,14H,2-5,7-8H2,1H3 |
| InChIKey | YNEATTPQZRLERG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|