C14H15N — CID 57078566
4a,6a,10a,11-tetrahydro-4H-benzo[c][1]benzazepine (PubChem CID 57078566) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is 4a,6a,10a,11-tetrahydro-4H-benzo[c][1]benzazepine.
| Compound Name | 4a,6a,10a,11-tetrahydro-4H-benzo[c][1]benzazepine |
|---|---|
| PubChem CID | 57078566 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4a,6a,10a,11-tetrahydro-4H-benzo[c][1]benzazepine |
| SMILES | C1=CCC2N=CC3C=CC=CC3CC2=C1 |
| InChI | InChI=1S/C14H15N/c1-2-7-13-10-15-14-8-4-3-6-12(14)9-11(13)5-1/h1-7,10-11,13-14H,8-9H2 |
| InChIKey | KFAGUWWZIAZWEV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |