C15H15N — CID 54068551
8-azatricyclo[10.4.0.02,7]hexadeca-3,5,8,11,13,15-hexaene (PubChem CID 54068551) has the molecular formula C15H15N and a molecular weight of 209.29 g/mol. Its IUPAC name is 8-azatricyclo[10.4.0.02,7]hexadeca-3,5,8,11,13,15-hexaene.
| Compound Name | 8-azatricyclo[10.4.0.02,7]hexadeca-3,5,8,11,13,15-hexaene |
|---|---|
| PubChem CID | 54068551 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 8-azatricyclo[10.4.0.02,7]hexadeca-3,5,8,11,13,15-hexaene |
| SMILES | C1=CC2=CC/C=N\C3C=CC=CC3C2C=C1 |
| InChI | InChI=1S/C15H15N/c1-2-8-13-12(6-1)7-5-11-16-15-10-4-3-9-14(13)15/h1-4,6-11,13-15H,5H2/b12-7?,16-11- |
| InChIKey | METQQNRBBBCART-KBYDIJCVSA-N |
| XLogP | 3.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |