C10H12FN — CID 91299299
3-ethyl-5-fluoro-3a,7a-dihydro-3H-indole (PubChem CID 91299299) has the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. Its IUPAC name is 3-ethyl-5-fluoro-3a,7a-dihydro-3H-indole.
| Compound Name | 3-ethyl-5-fluoro-3a,7a-dihydro-3H-indole |
|---|---|
| PubChem CID | 91299299 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 3-ethyl-5-fluoro-3a,7a-dihydro-3H-indole |
| SMILES | CCC1C=NC2C=CC(F)=CC12 |
| InChI | InChI=1S/C10H12FN/c1-2-7-6-12-10-4-3-8(11)5-9(7)10/h3-7,9-10H,2H2,1H3 |
| InChIKey | RPEFFAGGBGNCRW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |