C11H12N2 — CID 57046091
4,4a,4b,8a-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 57046091) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 4,4a,4b,8a-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 4,4a,4b,8a-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 57046091 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 4,4a,4b,8a-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | C1=CC2N=C3CN=CCC3C2C=C1 |
| InChI | InChI=1S/C11H12N2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-4,6,8-10H,5,7H2 |
| InChIKey | DBGNXUQFQRSJRZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |