C11H12N2 — CID 56993502
3,9-diazatricyclo[6.4.1.04,13]trideca-3,6,9,11-tetraene (PubChem CID 56993502) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 3,9-diazatricyclo[6.4.1.04,13]trideca-3,6,9,11-tetraene.
| Compound Name | 3,9-diazatricyclo[6.4.1.04,13]trideca-3,6,9,11-tetraene |
|---|---|
| PubChem CID | 56993502 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 3,9-diazatricyclo[6.4.1.04,13]trideca-3,6,9,11-tetraene |
| SMILES | C1=CC2CN=C3CC=CC(N=C1)C32 |
| InChI | InChI=1S/C11H12N2/c1-4-9-11-8(3-2-6-12-9)7-13-10(11)5-1/h1-4,6,8-9,11H,5,7H2 |
| InChIKey | RGQUONXCNVTUFL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|