C12H19N — CID 54266406
2-cycloheptyl-2,5-dihydropyridine (PubChem CID 54266406) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 2-cycloheptyl-2,5-dihydropyridine.
| Compound Name | 2-cycloheptyl-2,5-dihydropyridine |
|---|---|
| PubChem CID | 54266406 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 2-cycloheptyl-2,5-dihydropyridine |
| SMILES | C1=CC(C2CCCCCC2)N=CC1 |
| InChI | InChI=1S/C12H19N/c1-2-4-8-11(7-3-1)12-9-5-6-10-13-12/h5,9-12H,1-4,6-8H2 |
| InChIKey | DTQRIOLJNCQOHB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|