About 2-cyclohexyl-2,5-dihydropyridine
2-cyclohexyl-2,5-dihydropyridine (PubChem CID 54370120) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 2-cyclohexyl-2,5-dihydropyridine.
Molecular Properties
| Compound Name | 2-cyclohexyl-2,5-dihydropyridine |
| PubChem CID | 54370120 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 2-cyclohexyl-2,5-dihydropyridine |
| SMILES | C1=CC(C2CCCCC2)N=CC1 |
| InChI | InChI=1S/C11H17N/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h4,8-11H,1-3,5-7H2 |
| InChIKey | NBNPNYLNUZCSDZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-2,5-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-2,5-dihydropyridine?
The IUPAC name of 2-cyclohexyl-2,5-dihydropyridine (CID 54370120) is 2-cyclohexyl-2,5-dihydropyridine.
What is the SMILES notation for 2-cyclohexyl-2,5-dihydropyridine?
The canonical SMILES for 2-cyclohexyl-2,5-dihydropyridine is C1=CC(C2CCCCC2)N=CC1.
What is the InChIKey of 2-cyclohexyl-2,5-dihydropyridine?
The InChIKey is NBNPNYLNUZCSDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-2-6-10(7-3-1)11-8-4-5-9-12-11/h4,8-11H,1-3,5-7H2.
What are the key properties of 2-cyclohexyl-2,5-dihydropyridine?
2-cyclohexyl-2,5-dihydropyridine has a molecular weight of 163.26 g/mol, XLogP of 2.97, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-2,5-dihydropyridine is sourced from PubChem (CID 54370120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).