C15H25N — CID 23391680
N-cyclohexyl-1-(4,6-dimethylcyclohex-3-en-1-yl)methanimine (PubChem CID 23391680) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N-cyclohexyl-1-(4,6-dimethylcyclohex-3-en-1-yl)methanimine.
| Compound Name | N-cyclohexyl-1-(4,6-dimethylcyclohex-3-en-1-yl)methanimine |
|---|---|
| PubChem CID | 23391680 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N-cyclohexyl-1-(4,6-dimethylcyclohex-3-en-1-yl)methanimine |
| SMILES | CC1=CCC(/C=N/C2CCCCC2)C(C)C1 |
| InChI | InChI=1S/C15H25N/c1-12-8-9-14(13(2)10-12)11-16-15-6-4-3-5-7-15/h8,11,13-15H,3-7,9-10H2,1-2H3/b16-11+ |
| InChIKey | UINKGSJHGKYUHD-LFIBNONCSA-N |
| XLogP | 4.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|