About N-cyclohexyl-1-(4,6-dimethylcyclohex-3-en-1-yl)methanimine
N-cyclohexyl-1-(4,6-dimethylcyclohex-3-en-1-yl)methanimine (PubChem CID 23391680) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is N-cyclohexyl-1-(4,6-dimethylcyclohex-3-en-1-yl)methanimine.
Molecular Properties
| Compound Name | N-cyclohexyl-1-(4,6-dimethylcyclohex-3-en-1-yl)methanimine |
| PubChem CID | 23391680 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N-cyclohexyl-1-(4,6-dimethylcyclohex-3-en-1-yl)methanimine |
| SMILES | CC1=CCC(/C=N/C2CCCCC2)C(C)C1 |
| InChI | InChI=1S/C15H25N/c1-12-8-9-14(13(2)10-12)11-16-15-6-4-3-5-7-15/h8,11,13-15H,3-7,9-10H2,1-2H3/b16-11+ |
| InChIKey | UINKGSJHGKYUHD-LFIBNONCSA-N |
| XLogP | 4.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-1-(4,6-dimethylcyclohex-3-en-1-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-1-(4,6-dimethylcyclohex-3-en-1-yl)methanimine?
The IUPAC name of N-cyclohexyl-1-(4,6-dimethylcyclohex-3-en-1-yl)methanimine (CID 23391680) is N-cyclohexyl-1-(4,6-dimethylcyclohex-3-en-1-yl)methanimine.
What is the SMILES notation for N-cyclohexyl-1-(4,6-dimethylcyclohex-3-en-1-yl)methanimine?
The canonical SMILES for N-cyclohexyl-1-(4,6-dimethylcyclohex-3-en-1-yl)methanimine is CC1=CCC(/C=N/C2CCCCC2)C(C)C1.
What is the InChIKey of N-cyclohexyl-1-(4,6-dimethylcyclohex-3-en-1-yl)methanimine?
The InChIKey is UINKGSJHGKYUHD-LFIBNONCSA-N. The full InChI is InChI=1S/C15H25N/c1-12-8-9-14(13(2)10-12)11-16-15-6-4-3-5-7-15/h8,11,13-15H,3-7,9-10H2,1-2H3/b16-11+.
What are the key properties of N-cyclohexyl-1-(4,6-dimethylcyclohex-3-en-1-yl)methanimine?
N-cyclohexyl-1-(4,6-dimethylcyclohex-3-en-1-yl)methanimine has a molecular weight of 219.37 g/mol, XLogP of 4.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-1-(4,6-dimethylcyclohex-3-en-1-yl)methanimine is sourced from PubChem (CID 23391680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).