C9H13N — CID 57106728
(8aS)-1,4,6,7,8,8a-hexahydroisoquinoline (PubChem CID 57106728) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is (8aS)-1,4,6,7,8,8a-hexahydroisoquinoline.
| Compound Name | (8aS)-1,4,6,7,8,8a-hexahydroisoquinoline |
|---|---|
| PubChem CID | 57106728 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | (8aS)-1,4,6,7,8,8a-hexahydroisoquinoline |
| SMILES | C1=NC[C@H]2CCCC=C2C1 |
| InChI | InChI=1S/C9H13N/c1-2-4-9-7-10-6-5-8(9)3-1/h3,6,9H,1-2,4-5,7H2/t9-/m1/s1 |
| InChIKey | FCAFAXGHZBVSDA-SECBINFHSA-N |
| XLogP | 2.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|