C12H21N — CID 57118688
3,5-diethyl-2-propyl-2,5-dihydropyridine (PubChem CID 57118688) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 3,5-diethyl-2-propyl-2,5-dihydropyridine.
| Compound Name | 3,5-diethyl-2-propyl-2,5-dihydropyridine |
|---|---|
| PubChem CID | 57118688 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 3,5-diethyl-2-propyl-2,5-dihydropyridine |
| SMILES | CCCC1N=CC(CC)C=C1CC |
| InChI | InChI=1S/C12H21N/c1-4-7-12-11(6-3)8-10(5-2)9-13-12/h8-10,12H,4-7H2,1-3H3 |
| InChIKey | HTRAKOWTBCHWPJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|