C9H11BrN2 — CID 146550269
4-bromo-2,6-dimethylbenzenecarboximidamide (PubChem CID 146550269) has the molecular formula C9H11BrN2 and a molecular weight of 227.11 g/mol. Its IUPAC name is 4-bromo-2,6-dimethylbenzenecarboximidamide.
| Compound Name | 4-bromo-2,6-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 146550269 |
| Molecular Formula | C9H11BrN2 |
| Molecular Weight | 227.11 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 4-bromo-2,6-dimethylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C9H11BrN2/c1-5-3-7(10)4-6(2)8(5)9(11)12/h3-4H,1-2H3,(H3,11,12) |
| InChIKey | XKYKRKONRDQXDH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.11 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|