C14H13BrFN3O — CID 81332133
2-(3-bromo-5-fluorophenoxy)-4,6-dimethylpyridine-3-carboximidamide (PubChem CID 81332133) has the molecular formula C14H13BrFN3O and a molecular weight of 338.18 g/mol. Its IUPAC name is 2-(3-bromo-5-fluorophenoxy)-4,6-dimethylpyridine-3-carboximidamide.
| Compound Name | 2-(3-bromo-5-fluorophenoxy)-4,6-dimethylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 81332133 |
| Molecular Formula | C14H13BrFN3O |
| Molecular Weight | 338.18 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 2-(3-bromo-5-fluorophenoxy)-4,6-dimethylpyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)cc(C)nc1Oc1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C14H13BrFN3O/c1-7-3-8(2)19-14(12(7)13(17)18)20-11-5-9(15)4-10(16)6-11/h3-6H,1-2H3,(H3,17,18) |
| InChIKey | SYHXLWHDDBAUIC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.18 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|