C16H24FN — CID 106882828
(Z)-4-(2-fluoro-4,6-dimethylphenyl)-N-propan-2-ylpent-3-en-1-amine (PubChem CID 106882828) has the molecular formula C16H24FN and a molecular weight of 249.37 g/mol. Its IUPAC name is (Z)-4-(2-fluoro-4,6-dimethylphenyl)-N-propan-2-ylpent-3-en-1-amine.
| Compound Name | (Z)-4-(2-fluoro-4,6-dimethylphenyl)-N-propan-2-ylpent-3-en-1-amine |
|---|---|
| PubChem CID | 106882828 |
| Molecular Formula | C16H24FN |
| Molecular Weight | 249.37 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | (Z)-4-(2-fluoro-4,6-dimethylphenyl)-N-propan-2-ylpent-3-en-1-amine |
| SMILES | C/C(=C/CCNC(C)C)c1c(C)cc(C)cc1F |
| InChI | InChI=1S/C16H24FN/c1-11(2)18-8-6-7-13(4)16-14(5)9-12(3)10-15(16)17/h7,9-11,18H,6,8H2,1-5H3/b13-7- |
| InChIKey | WCHZCWJLSPDVTG-QPEQYQDCSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|