C16H24FN — CID 79607295
4-(4-fluoro-3-methylphenyl)-N-(2-methylpropyl)pent-3-en-1-amine (PubChem CID 79607295) has the molecular formula C16H24FN and a molecular weight of 249.37 g/mol. Its IUPAC name is 4-(4-fluoro-3-methylphenyl)-N-(2-methylpropyl)pent-3-en-1-amine.
| Compound Name | 4-(4-fluoro-3-methylphenyl)-N-(2-methylpropyl)pent-3-en-1-amine |
|---|---|
| PubChem CID | 79607295 |
| Molecular Formula | C16H24FN |
| Molecular Weight | 249.37 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | 4-(4-fluoro-3-methylphenyl)-N-(2-methylpropyl)pent-3-en-1-amine |
| SMILES | CC(=CCCNCC(C)C)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C16H24FN/c1-12(2)11-18-9-5-6-13(3)15-7-8-16(17)14(4)10-15/h6-8,10,12,18H,5,9,11H2,1-4H3 |
| InChIKey | MMDSREQZFYPOLI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|