C15H22FN — CID 79338174
3-(4-fluoro-3-methylphenyl)-2-methyl-N-(2-methylpropyl)prop-2-en-1-amine (PubChem CID 79338174) has the molecular formula C15H22FN and a molecular weight of 235.35 g/mol. Its IUPAC name is 3-(4-fluoro-3-methylphenyl)-2-methyl-N-(2-methylpropyl)prop-2-en-1-amine.
| Compound Name | 3-(4-fluoro-3-methylphenyl)-2-methyl-N-(2-methylpropyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 79338174 |
| Molecular Formula | C15H22FN |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 3-(4-fluoro-3-methylphenyl)-2-methyl-N-(2-methylpropyl)prop-2-en-1-amine |
| SMILES | CC(=Cc1ccc(F)c(C)c1)CNCC(C)C |
| InChI | InChI=1S/C15H22FN/c1-11(2)9-17-10-12(3)7-14-5-6-15(16)13(4)8-14/h5-8,11,17H,9-10H2,1-4H3 |
| InChIKey | SRVHRUSHXHGGGK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |