C15H20F3NS — CID 79341385
2-methyl-N-(2-methylpropyl)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-en-1-amine (PubChem CID 79341385) has the molecular formula C15H20F3NS and a molecular weight of 303.39 g/mol. Its IUPAC name is 2-methyl-N-(2-methylpropyl)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-en-1-amine.
| Compound Name | 2-methyl-N-(2-methylpropyl)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 79341385 |
| Molecular Formula | C15H20F3NS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-methyl-N-(2-methylpropyl)-3-[4-(trifluoromethylsulfanyl)phenyl]prop-2-en-1-amine |
| SMILES | CC(=Cc1ccc(SC(F)(F)F)cc1)CNCC(C)C |
| InChI | InChI=1S/C15H20F3NS/c1-11(2)9-19-10-12(3)8-13-4-6-14(7-5-13)20-15(16,17)18/h4-8,11,19H,9-10H2,1-3H3 |
| InChIKey | MXKAXAARTWSXJN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |