C14H18ClF2N — CID 114275301
(E)-4-(6-chloro-2,3-difluorophenyl)-N-(2-methylpropyl)but-3-en-1-amine (PubChem CID 114275301) has the molecular formula C14H18ClF2N and a molecular weight of 273.75 g/mol. Its IUPAC name is (E)-4-(6-chloro-2,3-difluorophenyl)-N-(2-methylpropyl)but-3-en-1-amine.
| Compound Name | (E)-4-(6-chloro-2,3-difluorophenyl)-N-(2-methylpropyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 114275301 |
| Molecular Formula | C14H18ClF2N |
| Molecular Weight | 273.75 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | (E)-4-(6-chloro-2,3-difluorophenyl)-N-(2-methylpropyl)but-3-en-1-amine |
| SMILES | CC(C)CNCC/C=C/c1c(Cl)ccc(F)c1F |
| InChI | InChI=1S/C14H18ClF2N/c1-10(2)9-18-8-4-3-5-11-12(15)6-7-13(16)14(11)17/h3,5-7,10,18H,4,8-9H2,1-2H3/b5-3+ |
| InChIKey | SPGMNWROYLOXPH-HWKANZROSA-N |
| XLogP | 4.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.75 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|