C15H21Cl2N — CID 79598142
5-(2,6-dichlorophenyl)-N-(2-methylpropyl)pent-3-en-1-amine (PubChem CID 79598142) has the molecular formula C15H21Cl2N and a molecular weight of 286.25 g/mol. Its IUPAC name is 5-(2,6-dichlorophenyl)-N-(2-methylpropyl)pent-3-en-1-amine.
| Compound Name | 5-(2,6-dichlorophenyl)-N-(2-methylpropyl)pent-3-en-1-amine |
|---|---|
| PubChem CID | 79598142 |
| Molecular Formula | C15H21Cl2N |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 5-(2,6-dichlorophenyl)-N-(2-methylpropyl)pent-3-en-1-amine |
| SMILES | CC(C)CNCCC=CCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H21Cl2N/c1-12(2)11-18-10-5-3-4-7-13-14(16)8-6-9-15(13)17/h3-4,6,8-9,12,18H,5,7,10-11H2,1-2H3 |
| InChIKey | SAJKLSNUMPHDCL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|