C13H17F2N — CID 79347750
N-[3-(2,6-difluorophenyl)prop-2-enyl]-2-methylpropan-1-amine (PubChem CID 79347750) has the molecular formula C13H17F2N and a molecular weight of 225.28 g/mol. Its IUPAC name is N-[3-(2,6-difluorophenyl)prop-2-enyl]-2-methylpropan-1-amine.
| Compound Name | N-[3-(2,6-difluorophenyl)prop-2-enyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 79347750 |
| Molecular Formula | C13H17F2N |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-[3-(2,6-difluorophenyl)prop-2-enyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCC=Cc1c(F)cccc1F |
| InChI | InChI=1S/C13H17F2N/c1-10(2)9-16-8-4-5-11-12(14)6-3-7-13(11)15/h3-7,10,16H,8-9H2,1-2H3 |
| InChIKey | XRQKGIAJMVAFSX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|