C12H15F2N — CID 103092570
(E)-4-(2,6-difluorophenyl)-N-ethylbut-3-en-2-amine (PubChem CID 103092570) has the molecular formula C12H15F2N and a molecular weight of 211.25 g/mol. Its IUPAC name is (E)-4-(2,6-difluorophenyl)-N-ethylbut-3-en-2-amine.
| Compound Name | (E)-4-(2,6-difluorophenyl)-N-ethylbut-3-en-2-amine |
|---|---|
| PubChem CID | 103092570 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | (E)-4-(2,6-difluorophenyl)-N-ethylbut-3-en-2-amine |
| SMILES | CCNC(C)/C=C/c1c(F)cccc1F |
| InChI | InChI=1S/C12H15F2N/c1-3-15-9(2)7-8-10-11(13)5-4-6-12(10)14/h4-9,15H,3H2,1-2H3/b8-7+ |
| InChIKey | FTAGSDIAPRKNST-BQYQJAHWSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |