C13H17Cl2N — CID 103092632
(E)-4-(2,3-dichlorophenyl)-N-propylbut-3-en-2-amine (PubChem CID 103092632) has the molecular formula C13H17Cl2N and a molecular weight of 258.19 g/mol. Its IUPAC name is (E)-4-(2,3-dichlorophenyl)-N-propylbut-3-en-2-amine.
| Compound Name | (E)-4-(2,3-dichlorophenyl)-N-propylbut-3-en-2-amine |
|---|---|
| PubChem CID | 103092632 |
| Molecular Formula | C13H17Cl2N |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | (E)-4-(2,3-dichlorophenyl)-N-propylbut-3-en-2-amine |
| SMILES | CCCNC(C)/C=C/c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H17Cl2N/c1-3-9-16-10(2)7-8-11-5-4-6-12(14)13(11)15/h4-8,10,16H,3,9H2,1-2H3/b8-7+ |
| InChIKey | YKBYYBWHBWKCHL-BQYQJAHWSA-N |
| XLogP | 4.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |