C17H27Cl2N — CID 115851225
1-(2,3-dichlorophenyl)-N,2-dipropylpentan-1-amine (PubChem CID 115851225) has the molecular formula C17H27Cl2N and a molecular weight of 316.32 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-N,2-dipropylpentan-1-amine.
| Compound Name | 1-(2,3-dichlorophenyl)-N,2-dipropylpentan-1-amine |
|---|---|
| PubChem CID | 115851225 |
| Molecular Formula | C17H27Cl2N |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-N,2-dipropylpentan-1-amine |
| SMILES | CCCNC(c1cccc(Cl)c1Cl)C(CCC)CCC |
| InChI | InChI=1S/C17H27Cl2N/c1-4-8-13(9-5-2)17(20-12-6-3)14-10-7-11-15(18)16(14)19/h7,10-11,13,17,20H,4-6,8-9,12H2,1-3H3 |
| InChIKey | FHBGOYCCVVQVFE-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |