About 4-(3,5-dimethylphenyl)-N-propan-2-ylbut-3-en-1-amine
4-(3,5-dimethylphenyl)-N-propan-2-ylbut-3-en-1-amine (PubChem CID 79591077) has the molecular formula C15H23N
and a molecular weight of 217.36 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-N-propan-2-ylbut-3-en-1-amine.
Molecular Properties
| Compound Name | 4-(3,5-dimethylphenyl)-N-propan-2-ylbut-3-en-1-amine |
| PubChem CID | 79591077 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-N-propan-2-ylbut-3-en-1-amine |
| SMILES | Cc1cc(C)cc(C=CCCNC(C)C)c1 |
| InChI | InChI=1S/C15H23N/c1-12(2)16-8-6-5-7-15-10-13(3)9-14(4)11-15/h5,7,9-12,16H,6,8H2,1-4H3 |
| InChIKey | AHMDRQCELRUVHZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-dimethylphenyl)-N-propan-2-ylbut-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylphenyl)-N-propan-2-ylbut-3-en-1-amine?
The IUPAC name of 4-(3,5-dimethylphenyl)-N-propan-2-ylbut-3-en-1-amine (CID 79591077) is 4-(3,5-dimethylphenyl)-N-propan-2-ylbut-3-en-1-amine.
What is the SMILES notation for 4-(3,5-dimethylphenyl)-N-propan-2-ylbut-3-en-1-amine?
The canonical SMILES for 4-(3,5-dimethylphenyl)-N-propan-2-ylbut-3-en-1-amine is Cc1cc(C)cc(C=CCCNC(C)C)c1.
What is the InChIKey of 4-(3,5-dimethylphenyl)-N-propan-2-ylbut-3-en-1-amine?
The InChIKey is AHMDRQCELRUVHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N/c1-12(2)16-8-6-5-7-15-10-13(3)9-14(4)11-15/h5,7,9-12,16H,6,8H2,1-4H3.
What are the key properties of 4-(3,5-dimethylphenyl)-N-propan-2-ylbut-3-en-1-amine?
4-(3,5-dimethylphenyl)-N-propan-2-ylbut-3-en-1-amine has a molecular weight of 217.36 g/mol, XLogP of 3.70, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylphenyl)-N-propan-2-ylbut-3-en-1-amine is sourced from PubChem (CID 79591077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).