C25H42O3Si — CID 10788191
[(E)-2-[tri(propan-2-yl)silyloxymethyl]pent-2-enyl] 2,4,6-trimethylbenzoate (PubChem CID 10788191) has the molecular formula C25H42O3Si and a molecular weight of 418.69 g/mol. Its IUPAC name is [(E)-2-[tri(propan-2-yl)silyloxymethyl]pent-2-enyl] 2,4,6-trimethylbenzoate.
| Compound Name | [(E)-2-[tri(propan-2-yl)silyloxymethyl]pent-2-enyl] 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 10788191 |
| Molecular Formula | C25H42O3Si |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | [(E)-2-[tri(propan-2-yl)silyloxymethyl]pent-2-enyl] 2,4,6-trimethylbenzoate |
| SMILES | CC/C=C(\COC(=O)c1c(C)cc(C)cc1C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H42O3Si/c1-11-12-23(16-28-29(17(2)3,18(4)5)19(6)7)15-27-25(26)24-21(9)13-20(8)14-22(24)10/h12-14,17-19H,11,15-16H2,1-10H3/b23-12+ |
| InChIKey | PNVKVOWROZMYPS-FSJBWODESA-N |
| XLogP | 7.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|