C13H23Cl2PRu — CID 10915927
dichlororuthenium;1,2,4,5-tetramethylbenzene;trimethylphosphane (PubChem CID 10915927) has the molecular formula C13H23Cl2PRu and a molecular weight of 382.28 g/mol. Its IUPAC name is dichlororuthenium;1,2,4,5-tetramethylbenzene;trimethylphosphane.
| Compound Name | dichlororuthenium;1,2,4,5-tetramethylbenzene;trimethylphosphane |
|---|---|
| PubChem CID | 10915927 |
| Molecular Formula | C13H23Cl2PRu |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | dichlororuthenium;1,2,4,5-tetramethylbenzene;trimethylphosphane |
| SMILES | CP(C)C.Cc1cc(C)c(C)cc1C.Cl[Ru]Cl |
| InChI | InChI=1S/C10H14.C3H9P.2ClH.Ru/c1-7-5-9(3)10(4)6-8(7)2;1-4(2)3;;;/h5-6H,1-4H3;1-3H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | DXWWFCDASBFANA-UHFFFAOYSA-L |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|