C10H22O4Si4 — CID 160644865
1,2,4,5-tetramethylbenzene;1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 160644865) has the molecular formula C10H22O4Si4 and a molecular weight of 318.63 g/mol. Its IUPAC name is 1,2,4,5-tetramethylbenzene;1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 1,2,4,5-tetramethylbenzene;1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 160644865 |
| Molecular Formula | C10H22O4Si4 |
| Molecular Weight | 318.63 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1,2,4,5-tetramethylbenzene;1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | Cc1cc(C)c(C)cc1C.O1[SiH2]O[SiH2]O[SiH2]O[SiH2]1 |
| InChI | InChI=1S/C10H14.H8O4Si4/c1-7-5-9(3)10(4)6-8(7)2;1-5-2-7-4-8-3-6-1/h5-6H,1-4H3;5-8H2 |
| InChIKey | RJQRBZFKZSMOAQ-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.63 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|