About CID 88509431
CID 88509431 (PubChem CID 88509431) has the molecular formula C9H10ClSn
and a molecular weight of 272.34 g/mol.
Molecular Properties
| Compound Name | CID 88509431 |
| PubChem CID | 88509431 |
| Molecular Formula | C9H10ClSn |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.95 |
| IUPAC Name | — |
| SMILES | CC(Cl)Cc1ccccc1[Sn] |
| InChI | InChI=1S/C9H10Cl.Sn/c1-8(10)7-9-5-3-2-4-6-9;/h2-5,8H,7H2,1H3; |
| InChIKey | HBBOGZSCMOFELQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze CID 88509431 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88509431?
The IUPAC name of CID 88509431 (CID 88509431) is not available.
What is the SMILES notation for CID 88509431?
The canonical SMILES for CID 88509431 is CC(Cl)Cc1ccccc1[Sn].
What is the InChIKey of CID 88509431?
The InChIKey is HBBOGZSCMOFELQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl.Sn/c1-8(10)7-9-5-3-2-4-6-9;/h2-5,8H,7H2,1H3;.
What are the key properties of CID 88509431?
CID 88509431 has a molecular weight of 272.34 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88509431 is sourced from PubChem (CID 88509431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).