methyl 2-[(2,4,5-trimethylphenyl)methylamino]propanoate

C14H21NO2 — CID 60781980

IUPACmethyl 2-[(2,4,5-trimethylphenyl)methylamino]propanoate
SMILESCOC(=O)C(C)NCc1cc(C)c(C)cc1C
InChIInChI=1S/C14H21NO2/c1-9-6-11(3)13(7-10(9)2)8-15-12(4)14(16)17-5/h6-7,12,15H,8H2,1-5H3
InChIKeyNEOJOVHJCMETPY-UHFFFAOYSA-N
MW235.33 g/mol
LogP2.26
Rot. Bonds4

About methyl 2-[(2,4,5-trimethylphenyl)methylamino]propanoate

methyl 2-[(2,4,5-trimethylphenyl)methylamino]propanoate (PubChem CID 60781980) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is methyl 2-[(2,4,5-trimethylphenyl)methylamino]propanoate.

Molecular Properties

Compound Namemethyl 2-[(2,4,5-trimethylphenyl)methylamino]propanoate
PubChem CID60781980
Molecular FormulaC14H21NO2
Molecular Weight235.33 g/mol
Exact Mass235.16
IUPAC Namemethyl 2-[(2,4,5-trimethylphenyl)methylamino]propanoate
SMILESCOC(=O)C(C)NCc1cc(C)c(C)cc1C
InChIInChI=1S/C14H21NO2/c1-9-6-11(3)13(7-10(9)2)8-15-12(4)14(16)17-5/h6-7,12,15H,8H2,1-5H3
InChIKeyNEOJOVHJCMETPY-UHFFFAOYSA-N
XLogP2.26
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.33
LogP ≤ 52.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-[(2,4,5-trimethylphenyl)methylamino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(2,4,5-trimethylphenyl)methylamino]propanoate?
The IUPAC name of methyl 2-[(2,4,5-trimethylphenyl)methylamino]propanoate (CID 60781980) is methyl 2-[(2,4,5-trimethylphenyl)methylamino]propanoate.
What is the SMILES notation for methyl 2-[(2,4,5-trimethylphenyl)methylamino]propanoate?
The canonical SMILES for methyl 2-[(2,4,5-trimethylphenyl)methylamino]propanoate is COC(=O)C(C)NCc1cc(C)c(C)cc1C.
What is the InChIKey of methyl 2-[(2,4,5-trimethylphenyl)methylamino]propanoate?
The InChIKey is NEOJOVHJCMETPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-9-6-11(3)13(7-10(9)2)8-15-12(4)14(16)17-5/h6-7,12,15H,8H2,1-5H3.
What are the key properties of methyl 2-[(2,4,5-trimethylphenyl)methylamino]propanoate?
methyl 2-[(2,4,5-trimethylphenyl)methylamino]propanoate has a molecular weight of 235.33 g/mol, XLogP of 2.26, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2,4,5-trimethylphenyl)methylamino]propanoate is sourced from PubChem (CID 60781980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).