C24H32O2 — CID 25266136
[(1S)-1-deuterio-2-phenylethyl] 2,4,6-tri(propan-2-yl)benzoate (PubChem CID 25266136) has the molecular formula C24H32O2 and a molecular weight of 353.52 g/mol. Its IUPAC name is [(1S)-1-deuterio-2-phenylethyl] 2,4,6-tri(propan-2-yl)benzoate.
| Compound Name | [(1S)-1-deuterio-2-phenylethyl] 2,4,6-tri(propan-2-yl)benzoate |
|---|---|
| PubChem CID | 25266136 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 353.52 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | [(1S)-1-deuterio-2-phenylethyl] 2,4,6-tri(propan-2-yl)benzoate |
| SMILES | [2H][C@@H](Cc1ccccc1)OC(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C24H32O2/c1-16(2)20-14-21(17(3)4)23(22(15-20)18(5)6)24(25)26-13-12-19-10-8-7-9-11-19/h7-11,14-18H,12-13H2,1-6H3/i13D/t13-/m0/s1 |
| InChIKey | XUJAKENYCWDKCU-GFAIVKHWSA-N |
| XLogP | 6.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.52 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |