C24H33ClO5S — CID 91593273
benzyl 2-hydroxyacetate;2,4,6-tri(propan-2-yl)benzenesulfonyl chloride (PubChem CID 91593273) has the molecular formula C24H33ClO5S and a molecular weight of 469.04 g/mol. Its IUPAC name is benzyl 2-hydroxyacetate;2,4,6-tri(propan-2-yl)benzenesulfonyl chloride.
| Compound Name | benzyl 2-hydroxyacetate;2,4,6-tri(propan-2-yl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 91593273 |
| Molecular Formula | C24H33ClO5S |
| Molecular Weight | 469.04 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | benzyl 2-hydroxyacetate;2,4,6-tri(propan-2-yl)benzenesulfonyl chloride |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)Cl)c(C(C)C)c1.O=C(CO)OCc1ccccc1 |
| InChI | InChI=1S/C15H23ClO2S.C9H10O3/c1-9(2)12-7-13(10(3)4)15(19(16,17)18)14(8-12)11(5)6;10-6-9(11)12-7-8-4-2-1-3-5-8/h7-11H,1-6H3;1-5,10H,6-7H2 |
| InChIKey | PYLCAGIRPCTULW-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.04 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |