C29H44OSi — CID 44514589
(1R)-1-propan-2-yl-1-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-3,4-dihydro-2H-1-benzosiline (PubChem CID 44514589) has the molecular formula C29H44OSi and a molecular weight of 436.76 g/mol. Its IUPAC name is (1R)-1-propan-2-yl-1-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-3,4-dihydro-2H-1-benzosiline.
| Compound Name | (1R)-1-propan-2-yl-1-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-3,4-dihydro-2H-1-benzosiline |
|---|---|
| PubChem CID | 44514589 |
| Molecular Formula | C29H44OSi |
| Molecular Weight | 436.76 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | (1R)-1-propan-2-yl-1-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]-3,4-dihydro-2H-1-benzosiline |
| SMILES | CC(C)c1cc(C(C)C)c([C@@H](C)O[Si@@]2(C(C)C)CCCc3ccccc32)c(C(C)C)c1 |
| InChI | InChI=1S/C29H44OSi/c1-19(2)25-17-26(20(3)4)29(27(18-25)21(5)6)23(9)30-31(22(7)8)16-12-14-24-13-10-11-15-28(24)31/h10-11,13,15,17-23H,12,14,16H2,1-9H3/t23-,31-/m1/s1 |
| InChIKey | FRGGSASPFLBIES-SLGOVJDISA-N |
| XLogP | 8.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.76 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|