C21H25Cl2FO4S2 — CID 174560865
1-[1-(4-fluorophenyl)prop-2-enylsulfonyl]-2,4-di(propan-2-yl)benzene;sulfuryl dichloride (PubChem CID 174560865) has the molecular formula C21H25Cl2FO4S2 and a molecular weight of 495.47 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)prop-2-enylsulfonyl]-2,4-di(propan-2-yl)benzene;sulfuryl dichloride.
| Compound Name | 1-[1-(4-fluorophenyl)prop-2-enylsulfonyl]-2,4-di(propan-2-yl)benzene;sulfuryl dichloride |
|---|---|
| PubChem CID | 174560865 |
| Molecular Formula | C21H25Cl2FO4S2 |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | 1-[1-(4-fluorophenyl)prop-2-enylsulfonyl]-2,4-di(propan-2-yl)benzene;sulfuryl dichloride |
| SMILES | C=CC(c1ccc(F)cc1)S(=O)(=O)c1ccc(C(C)C)cc1C(C)C.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C21H25FO2S.Cl2O2S/c1-6-20(16-7-10-18(22)11-8-16)25(23,24)21-12-9-17(14(2)3)13-19(21)15(4)5;1-5(2,3)4/h6-15,20H,1H2,2-5H3; |
| InChIKey | JYLLSFBZZNRQRT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|