C21H25FO2S — CID 174560866
1-[1-(4-fluorophenyl)prop-2-enylsulfonyl]-2,4-di(propan-2-yl)benzene (PubChem CID 174560866) has the molecular formula C21H25FO2S and a molecular weight of 360.49 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)prop-2-enylsulfonyl]-2,4-di(propan-2-yl)benzene.
| Compound Name | 1-[1-(4-fluorophenyl)prop-2-enylsulfonyl]-2,4-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 174560866 |
| Molecular Formula | C21H25FO2S |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-[1-(4-fluorophenyl)prop-2-enylsulfonyl]-2,4-di(propan-2-yl)benzene |
| SMILES | C=CC(c1ccc(F)cc1)S(=O)(=O)c1ccc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C21H25FO2S/c1-6-20(16-7-10-18(22)11-8-16)25(23,24)21-12-9-17(14(2)3)13-19(21)15(4)5/h6-15,20H,1H2,2-5H3 |
| InChIKey | ISPPQEFNCAXNEM-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|