C18H22Cl2O4S2 — CID 174560883
1-(benzenesulfonyl)-2,4-di(propan-2-yl)benzene;sulfuryl dichloride (PubChem CID 174560883) has the molecular formula C18H22Cl2O4S2 and a molecular weight of 437.41 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2,4-di(propan-2-yl)benzene;sulfuryl dichloride.
| Compound Name | 1-(benzenesulfonyl)-2,4-di(propan-2-yl)benzene;sulfuryl dichloride |
|---|---|
| PubChem CID | 174560883 |
| Molecular Formula | C18H22Cl2O4S2 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 1-(benzenesulfonyl)-2,4-di(propan-2-yl)benzene;sulfuryl dichloride |
| SMILES | CC(C)c1ccc(S(=O)(=O)c2ccccc2)c(C(C)C)c1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C18H22O2S.Cl2O2S/c1-13(2)15-10-11-18(17(12-15)14(3)4)21(19,20)16-8-6-5-7-9-16;1-5(2,3)4/h5-14H,1-4H3; |
| InChIKey | VICGCPFZQVMILX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |