C21H22N2O2S — CID 67042946
(1S,2S)-1-[4-(2-methylphenyl)sulfonylphenyl]-2-phenylethane-1,2-diamine (PubChem CID 67042946) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is (1S,2S)-1-[4-(2-methylphenyl)sulfonylphenyl]-2-phenylethane-1,2-diamine.
| Compound Name | (1S,2S)-1-[4-(2-methylphenyl)sulfonylphenyl]-2-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 67042946 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | (1S,2S)-1-[4-(2-methylphenyl)sulfonylphenyl]-2-phenylethane-1,2-diamine |
| SMILES | Cc1ccccc1S(=O)(=O)c1ccc([C@H](N)[C@@H](N)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H22N2O2S/c1-15-7-5-6-10-19(15)26(24,25)18-13-11-17(12-14-18)21(23)20(22)16-8-3-2-4-9-16/h2-14,20-21H,22-23H2,1H3/t20-,21-/m0/s1 |
| InChIKey | GKHJDRHJFBZVSJ-SFTDATJTSA-N |
| XLogP | 3.53 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |