About (1S,2S)-1-[4-(2-methylphenyl)sulfonylphenyl]-2-phenylethane-1,2-diamine
(1S,2S)-1-[4-(2-methylphenyl)sulfonylphenyl]-2-phenylethane-1,2-diamine (PubChem CID 67042946) has the molecular formula C21H22N2O2S
and a molecular weight of 366.49 g/mol. Its IUPAC name is (1S,2S)-1-[4-(2-methylphenyl)sulfonylphenyl]-2-phenylethane-1,2-diamine.
Molecular Properties
| Compound Name | (1S,2S)-1-[4-(2-methylphenyl)sulfonylphenyl]-2-phenylethane-1,2-diamine |
| PubChem CID | 67042946 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | (1S,2S)-1-[4-(2-methylphenyl)sulfonylphenyl]-2-phenylethane-1,2-diamine |
| SMILES | Cc1ccccc1S(=O)(=O)c1ccc([C@H](N)[C@@H](N)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H22N2O2S/c1-15-7-5-6-10-19(15)26(24,25)18-13-11-17(12-14-18)21(23)20(22)16-8-3-2-4-9-16/h2-14,20-21H,22-23H2,1H3/t20-,21-/m0/s1 |
| InChIKey | GKHJDRHJFBZVSJ-SFTDATJTSA-N |
| XLogP | 3.53 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S,2S)-1-[4-(2-methylphenyl)sulfonylphenyl]-2-phenylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-1-[4-(2-methylphenyl)sulfonylphenyl]-2-phenylethane-1,2-diamine?
The IUPAC name of (1S,2S)-1-[4-(2-methylphenyl)sulfonylphenyl]-2-phenylethane-1,2-diamine (CID 67042946) is (1S,2S)-1-[4-(2-methylphenyl)sulfonylphenyl]-2-phenylethane-1,2-diamine.
What is the SMILES notation for (1S,2S)-1-[4-(2-methylphenyl)sulfonylphenyl]-2-phenylethane-1,2-diamine?
The canonical SMILES for (1S,2S)-1-[4-(2-methylphenyl)sulfonylphenyl]-2-phenylethane-1,2-diamine is Cc1ccccc1S(=O)(=O)c1ccc([C@H](N)[C@@H](N)c2ccccc2)cc1.
What is the InChIKey of (1S,2S)-1-[4-(2-methylphenyl)sulfonylphenyl]-2-phenylethane-1,2-diamine?
The InChIKey is GKHJDRHJFBZVSJ-SFTDATJTSA-N. The full InChI is InChI=1S/C21H22N2O2S/c1-15-7-5-6-10-19(15)26(24,25)18-13-11-17(12-14-18)21(23)20(22)16-8-3-2-4-9-16/h2-14,20-21H,22-23H2,1H3/t20-,21-/m0/s1.
What are the key properties of (1S,2S)-1-[4-(2-methylphenyl)sulfonylphenyl]-2-phenylethane-1,2-diamine?
(1S,2S)-1-[4-(2-methylphenyl)sulfonylphenyl]-2-phenylethane-1,2-diamine has a molecular weight of 366.49 g/mol, XLogP of 3.53, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-1-[4-(2-methylphenyl)sulfonylphenyl]-2-phenylethane-1,2-diamine is sourced from PubChem (CID 67042946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).