C18H18ClNO4S — CID 174689122
4-amino-1-chloro-5-[4-(2-methylphenyl)sulfonylphenyl]pentane-2,3-dione (PubChem CID 174689122) has the molecular formula C18H18ClNO4S and a molecular weight of 379.87 g/mol. Its IUPAC name is 4-amino-1-chloro-5-[4-(2-methylphenyl)sulfonylphenyl]pentane-2,3-dione.
| Compound Name | 4-amino-1-chloro-5-[4-(2-methylphenyl)sulfonylphenyl]pentane-2,3-dione |
|---|---|
| PubChem CID | 174689122 |
| Molecular Formula | C18H18ClNO4S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 4-amino-1-chloro-5-[4-(2-methylphenyl)sulfonylphenyl]pentane-2,3-dione |
| SMILES | Cc1ccccc1S(=O)(=O)c1ccc(CC(N)C(=O)C(=O)CCl)cc1 |
| InChI | InChI=1S/C18H18ClNO4S/c1-12-4-2-3-5-17(12)25(23,24)14-8-6-13(7-9-14)10-15(20)18(22)16(21)11-19/h2-9,15H,10-11,20H2,1H3 |
| InChIKey | QZAUTJCZKJJUJE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|