C17H21NO5S — CID 86738996
(2S)-2-amino-3-phenylpropanoic acid;2,5-dimethylbenzenesulfonic acid (PubChem CID 86738996) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is (2S)-2-amino-3-phenylpropanoic acid;2,5-dimethylbenzenesulfonic acid.
| Compound Name | (2S)-2-amino-3-phenylpropanoic acid;2,5-dimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 86738996 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (2S)-2-amino-3-phenylpropanoic acid;2,5-dimethylbenzenesulfonic acid |
| SMILES | Cc1ccc(C)c(S(=O)(=O)O)c1.N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H11NO2.C8H10O3S/c10-8(9(11)12)6-7-4-2-1-3-5-7;1-6-3-4-7(2)8(5-6)12(9,10)11/h1-5,8H,6,10H2,(H,11,12);3-5H,1-2H3,(H,9,10,11)/t8-;/m0./s1 |
| InChIKey | YFXTZNCMBKBNKH-QRPNPIFTSA-N |
| XLogP | 2.19 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|