C21H22N2O2S — CID 68639421
1-(2-methylphenyl)sulfonyl-1,2-diphenylethane-1,2-diamine (PubChem CID 68639421) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is 1-(2-methylphenyl)sulfonyl-1,2-diphenylethane-1,2-diamine.
| Compound Name | 1-(2-methylphenyl)sulfonyl-1,2-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 68639421 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 1-(2-methylphenyl)sulfonyl-1,2-diphenylethane-1,2-diamine |
| SMILES | Cc1ccccc1S(=O)(=O)C(N)(c1ccccc1)C(N)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O2S/c1-16-10-8-9-15-19(16)26(24,25)21(23,18-13-6-3-7-14-18)20(22)17-11-4-2-5-12-17/h2-15,20H,22-23H2,1H3 |
| InChIKey | GTSGWURBLNTEBZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |