C30H33ClN2O2RuS — CID 161117073
N-[(1S,2S)-2-amino-1-chloro-1,2-diphenylethyl]-4-methylbenzenesulfonamide;ruthenium;1,3,5-trimethylbenzene (PubChem CID 161117073) has the molecular formula C30H33ClN2O2RuS and a molecular weight of 622.20 g/mol. Its IUPAC name is N-[(1S,2S)-2-amino-1-chloro-1,2-diphenylethyl]-4-methylbenzenesulfonamide;ruthenium;1,3,5-trimethylbenzene.
| Compound Name | N-[(1S,2S)-2-amino-1-chloro-1,2-diphenylethyl]-4-methylbenzenesulfonamide;ruthenium;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 161117073 |
| Molecular Formula | C30H33ClN2O2RuS |
| Molecular Weight | 622.20 g/mol |
| Exact Mass | 622.10 |
| IUPAC Name | N-[(1S,2S)-2-amino-1-chloro-1,2-diphenylethyl]-4-methylbenzenesulfonamide;ruthenium;1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)cc(C)c1.Cc1ccc(S(=O)(=O)N[C@](Cl)(c2ccccc2)[C@@H](N)c2ccccc2)cc1.[Ru] |
| InChI | InChI=1S/C21H21ClN2O2S.C9H12.Ru/c1-16-12-14-19(15-13-16)27(25,26)24-21(22,18-10-6-3-7-11-18)20(23)17-8-4-2-5-9-17;1-7-4-8(2)6-9(3)5-7;/h2-15,20,24H,23H2,1H3;4-6H,1-3H3;/t20-,21+;;/m0../s1 |
| InChIKey | UKLNQYVYGKUVFY-DDZPGPNZSA-N |
| XLogP | 6.67 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.20 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|